Home|About Us|Download|FAQ|Hot Products

I08-0055 Quinoline-2,3-dicarboxylic acid dimethylester (CAS# 17507-03-8)

Quinoline-2,3-dicarboxylic acid dimethylester 17507-03-8

General Information
Catalog No.:	I08-0055
Synonym:	2,3-Quinolinedicarboxylic acid dimethyl ester
Cas#:	17507-03-8
MDL# :	MFCD00434841
Molecular Formula:	C13H11NO4
Mole Weight:	245.07

Useful Links

Certificate of Analysis

MSDS [PDF]

Inquiry Online

Salutation:

Country:

Customer:

Company:

Email:

Requested quantity:

Remarks:

Related products

Quinoline-2,3-dicarboxylic acid dimethylester

ethyl 6-methoxy-4-oxo-1,4-dihydroquinoline-3-carboxylate

Indole-2,5-dicarboxylic acid-2-ethyl ester-5-methyl ester

6-Methoxycarbonylindole-2-carboxylic acid ethyl ester

dimethyl 1H-indole-2,6-dicarboxylate

Ethyl 3-formyl-5-methoxy-1H-indole-2-carboxylate

Related pages:

Search Quinoline-2,3-dicarboxylic acid dimethylester in google

Search in google

Search Cas in google

Search Formula C13H11NO4 in google

O=C(C2=C(C(OC)=O)C=C1C=CC=CC1=N2)OC
  CDK  02091212062D

18 19  0  0  0  0            999 V2000
   -0.7145   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  2  0  0  0  0
  3  5  1  0  0  0  0
  5  6  2  0  0  0  0
  6  7  1  0  0  0  0
  7  8  2  0  0  0  0
  8  9  1  0  0  0  0
  9 10  2  0  0  0  0
 10 11  1  0  0  0  0
 11 12  2  0  0  0  0
 12 13  1  0  0  0  0
  8 13  1  0  0  0  0
 13 14  2  0  0  0  0
  5 14  1  0  0  0  0
  6 15  1  0  0  0  0
 15 16  2  0  0  0  0
 15 17  1  0  0  0  0
 17 18  1  0  0  0  0
M  END

Privacy |Terms and ConditionsCopyrights © 2010 IS Chemical Technology Ltd. All Rights Reserved.

沪ICP备09033181号