Home|About Us|Download|FAQ|Hot Products

I01-0033 1-Bromo-3-fluoro-4-(trifluoromethoxy)benzene (CAS# 105529-58-6)

1-Bromo-3-fluoro-4-(trifluoromethoxy)benzene 105529-58-6

General Information
Catalog No.:	I01-0033
Synonym:	1-Bromo-3-fluoro-4-(trifluoromethoxy)benzene
Cas#:	105529-58-6
MDL# :	MFCD01861132
Molecular Formula:	C7H3BrF4O
Mole Weight:	259.0

Useful Links

Certificate of Analysis

MSDS [PDF]

Inquiry Online

Salutation:

Country:

Customer:

Company:

Email:

Requested quantity:

Remarks:

Reference info	Ref#	Purity/Analysis Method	Availability	Update At
	20111201293	99 /Others	0.0	2011-12-19 09:34
	20111201198	98 /Others	0.0	2011-12-16 12:23

Related products

1-Bromo-3-fluoro-4-(trifluoromethoxy)benzene

1-bromo-2-fluoro-4-(trifluoromethoxy)benzene

1-bromo-2-fluoro-5-(Trifluoromethoxy)benzene

1-Bromo-2-fluoro-3-(trifluoromethoxy)benzene

4-bromo-2-fluoro-1-(trifluoromethoxy)benzene

1-BROMO-2-FLUORO-3-(TRIFLUOROMETHOXY)BENZENE

Related pages:

Search 1-Bromo-3-fluoro-4-(trifluoromethoxy)benzene in google

Search in google

Search Cas in google

Search Formula C7H3BrF4O in google

FC(F)(F)OC1=CC=C(Br)C=C1F
  CDK  02071222522D

13 13  0  0  0  0            999 V2000
    0.7145    2.0625    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    0.4125    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8414    1.5395    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0164    0.1105    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  2  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  4  6  2  0  0  0  0
  6  7  1  0  0  0  0
  7  8  2  0  0  0  0
  2  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 10 12  1  0  0  0  0
 10 13  1  0  0  0  0
M  END

Privacy |Terms and ConditionsCopyrights © 2010 IS Chemical Technology Ltd. All Rights Reserved.

沪ICP备09033181号