Home|About Us|Download|FAQ|Hot Products

I12-0004 1-BOC-3-AMINOPIPERIDINE (CAS# 184637-48-7)

1-BOC-3-AMINOPIPERIDINE 184637-48-7

General Information
Catalog No.:	I12-0004
Synonym:	3-Amino-1-N-Boc-piperidine; 3-Aminopiperidine-1-carboxylic acid tert-butyl ester
Cas#:	184637-48-7
MDL# :	MFCD01861219
Molecular Formula:	C10H20N2O2
Mole Weight:	200.28

Useful Links

Certificate of Analysis

MSDS [PDF]

Inquiry Online

Salutation:

Country:

Customer:

Company:

Email:

Requested quantity:

Remarks:

Reference info	Ref#	Purity/Analysis Method	Availability	Update At
	20111201113	97 /Others	0.0	2011-12-15 13:48

Related products

tert-butyl (s)-3-amino-1-piperidinecarboxylate

(R)-3-BOC-AMINOPIPERIDINE

1-BOC-3-AMINOPIPERIDINE

4-BOC-AMINOPIPERIDINE

3-BOC-AMINOPIPERIDINE

4-AMINO-1-BOC-PIPERIDINE

Related pages:

Search 1-BOC-3-AMINOPIPERIDINE in google

Search in google

Search Cas in google

Search Formula C10H20N2O2 in google

N1(C(=O)OC(C)(C)C)CC(CCC1)N
  CDK  02081218302D

14 14  0  0  0  0            999 V2000
    0.0000    4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8250    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8250    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  2  4  1  0  0  0  0
  2  5  1  0  0  0  0
  5  6  1  0  0  0  0
  6  7  2  0  0  0  0
  6  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
 12 14  1  0  0  0  0
  8 14  1  0  0  0  0
M  END

Privacy |Terms and ConditionsCopyrights © 2010 IS Chemical Technology Ltd. All Rights Reserved.

沪ICP备09033181号