Home|About Us|Download|FAQ|Hot Products

S03-0005 ethyl 4-amino-2-(methylthio)pyrimidine-5-carboxylate (CAS# 776-53-4)

ethyl 4-amino-2-(methylthio)pyrimidine-5-carboxylate 776-53-4

General Information
Catalog No.:	S03-0005
Synonym:	Ethyl 4-amino-2-(methylsulfanyl)-5-pyrimidinecarboxylate
Cas#:	776-53-4
MDL# :	MFCD00090781
Molecular Formula:	C8H11N3O2S
Mole Weight:	213.3

Useful Links

Certificate of Analysis

MSDS [PDF]

Inquiry Online

Salutation:

Country:

Customer:

Company:

Email:

Requested quantity:

Remarks:

Related products

ethyl 4-amino-2-(methylthio)pyrimidine-5-carboxylate

4-Chloro-2-methylsulfanyl-pyrimidine-5-carboxylic acid ethyl ester

ethyl 4-chloro-2-(methylthio)pyrimidine-5-carboxylate

methyl 2-(trifluoromethyl)pyrimidine-4-carboxylate

4-Amino-2-ethylsulfanyl-pyrimidine-5-carboxylic acid ethyl ester

methyl 3-(2-amino-6-chloropyrimidin-4-ylthio)propanoate

Related pages:

Search ethyl 4-amino-2-(methylthio)pyrimidine-5-carboxylate in google

Search in google

Search Cas in google

Search Formula C8H11N3O2S in google

CSC1=NC=C(C(OCC)=O)C(N)=N1
  CDK  02071222382D

14 14  0  0  0  0            999 V2000
   -0.7145    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  2  0  0  0  0
  4  6  1  0  0  0  0
  6  7  2  0  0  0  0
  7  8  1  0  0  0  0
  8  9  2  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
  9 12  1  0  0  0  0
 12 13  2  0  0  0  0
  6 13  1  0  0  0  0
 13 14  1  0  0  0  0
M  END

Privacy |Terms and ConditionsCopyrights © 2010 IS Chemical Technology Ltd. All Rights Reserved.

沪ICP备09033181号